Products 92614-57-8
CAS 92614-57-8 appears in our catalog under these names: 4-((Chlorosulfonyl)methyl)benzoic acid, 4-((Chlorosulfonyl)methyl)benzoic acid, 95%, 4-[(chlorosulfonyl)methyl]benzoic acid, 95%. Offered by: Biosynth, Ambeed, Chemat, BLDpharm, Fluorochem. Available pack sizes: 10g, 1g, 250mg, 5g.
4-(chlorosulfonylmethyl)benzoic acid (CAS 92614-57-8) is a chemical compound with the molecular formula C8H7ClO4S and a molecular weight of 234.66 g/mol. IUPAC name: 4-(chlorosulfonylmethyl)benzoic acid. InChIKey: DAGYFDUEPISFBZ-UHFFFAOYSA-N.
| Molecular formula | C8H7ClO4S |
|---|---|
| Molecular weight | 234.66 g/mol |
| IUPAC name | 4-(chlorosulfonylmethyl)benzoic acid |
| InChIKey | DAGYFDUEPISFBZ-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1CS(=O)(=O)Cl)C(=O)O |
Computed by PubChem (NCBI)