CAS 926195-36-0 appears in our catalog under these names: 2-{2,4-dioxo-1,3-diazaspiro(4.4)nonan-3-yl}propanoic acid, 95%, 2-{2,4-Dioxo-1,3-diazaspiro(4.4)nonan-3-yl}propanoic acid. Offered by: AmBeed, Biosynth. Available pack sizes: 10g, 5g, 100mg, 1g.
2-(2,4-dioxo-1,3-diazaspiro[4.4]nonan-3-yl)propanoic acid (CAS 926195-36-0) is a chemical compound with the molecular formula C10H14N2O4 and a molecular weight of 226.23 g/mol. IUPAC name: 2-(2,4-dioxo-1,3-diazaspiro[4.4]nonan-3-yl)propanoic acid. InChIKey: VLCOWQPLEBOIIE-UHFFFAOYSA-N.
| Molecular formula | C10H14N2O4 |
|---|---|
| Molecular weight | 226.23 g/mol |
| IUPAC name | 2-(2,4-dioxo-1,3-diazaspiro[4.4]nonan-3-yl)propanoic acid |
| InChIKey | VLCOWQPLEBOIIE-UHFFFAOYSA-N |
| SMILES | CC(C(=O)O)N1C(=O)C2(CCCC2)NC1=O |
Computed by PubChem (NCBI)