CAS 926199-43-1 appears in our catalog under these names: N-(3-Aminophenyl)propane-1-sulfonamide, N-(3-Aminophenyl)propane-1-sulfonamide, 95%. Offered by: Biosynth, AmBeed. Available pack sizes: 100mg, 1g, 5g.
N-(3-aminophenyl)propane-1-sulfonamide (CAS 926199-43-1) is a chemical compound with the molecular formula C9H14N2O2S and a molecular weight of 214.29 g/mol. IUPAC name: N-(3-aminophenyl)propane-1-sulfonamide. InChIKey: LPMNLIMUVRBXNG-UHFFFAOYSA-N.
| Molecular formula | C9H14N2O2S |
|---|---|
| Molecular weight | 214.29 g/mol |
| IUPAC name | N-(3-aminophenyl)propane-1-sulfonamide |
| InChIKey | LPMNLIMUVRBXNG-UHFFFAOYSA-N |
| SMILES | CCCS(=O)(=O)NC1=CC=CC(=C1)N |
Computed by PubChem (NCBI)