CAS 926207-60-5 appears in our catalog under these names: 2,4-Dimethyl-5-sulfamoylbenzoic acid, 2,4-Dimethyl-5-sulfamoylbenzoic acid, 95%. Offered by: Biosynth, AmBeed. Available pack sizes: 250mg, 2,5g, 5g.
2,4-dimethyl-5-sulfamoylbenzoic acid (CAS 926207-60-5) is a chemical compound with the molecular formula C9H11NO4S and a molecular weight of 229.26 g/mol. IUPAC name: 2,4-dimethyl-5-sulfamoylbenzoic acid. InChIKey: NKIVRTVICDLGDU-UHFFFAOYSA-N.
| Molecular formula | C9H11NO4S |
|---|---|
| Molecular weight | 229.26 g/mol |
| IUPAC name | 2,4-dimethyl-5-sulfamoylbenzoic acid |
| InChIKey | NKIVRTVICDLGDU-UHFFFAOYSA-N |
| SMILES | CC1=CC(=C(C=C1C(=O)O)S(=O)(=O)N)C |
Computed by PubChem (NCBI)