Products 926207-60-5

CAS 926207-60-5 appears in our catalog under these names: 2,4-Dimethyl-5-sulfamoylbenzoic acid, 2,4-Dimethyl-5-sulfamoylbenzoic acid, 95%. Offered by: Biosynth, AmBeed. Available pack sizes: 250mg, 2,5g, 5g.

2,4-dimethyl-5-sulfamoylbenzoic acid (CAS 926207-60-5) is a chemical compound with the molecular formula C9H11NO4S and a molecular weight of 229.26 g/mol. IUPAC name: 2,4-dimethyl-5-sulfamoylbenzoic acid. InChIKey: NKIVRTVICDLGDU-UHFFFAOYSA-N.

Identity
Molecular formulaC9H11NO4S
Molecular weight229.26 g/mol
IUPAC name2,4-dimethyl-5-sulfamoylbenzoic acid
InChIKeyNKIVRTVICDLGDU-UHFFFAOYSA-N
SMILESCC1=CC(=C(C=C1C(=O)O)S(=O)(=O)N)C

Computed by PubChem (NCBI)