CAS 926217-84-7 appears in our catalog under these names: 3-(2-Bromo-4-chlorophenoxy)propanoic acid, 95%, 3-(2-Bromo-4-chlorophenoxy)propanoic acid. Offered by: AmBeed, Biosynth. Available pack sizes: 5g, 250mg, 2,5g.
3-(2-bromo-4-chlorophenoxy)propanoic acid (CAS 926217-84-7) is a chemical compound with the molecular formula C9H8BrClO3 and a molecular weight of 279.51 g/mol. IUPAC name: 3-(2-bromo-4-chlorophenoxy)propanoic acid. InChIKey: UDSPEOKXKCJLJT-UHFFFAOYSA-N.
| Molecular formula | C9H8BrClO3 |
|---|---|
| Molecular weight | 279.51 g/mol |
| IUPAC name | 3-(2-bromo-4-chlorophenoxy)propanoic acid |
| InChIKey | UDSPEOKXKCJLJT-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1Cl)Br)OCCC(=O)O |
Computed by PubChem (NCBI)