CAS 926233-40-1 is the registry number for 4-Sulfamoyl-5,6,7,8-tetrahydronaphthalene-2-carboxylic acid, 95%. Offered by: AmBeed. Available pack sizes: 5g, 1g.
4-sulfamoyl-5,6,7,8-tetrahydronaphthalene-2-carboxylic acid (CAS 926233-40-1) is a chemical compound with the molecular formula C11H13NO4S and a molecular weight of 255.29 g/mol. IUPAC name: 4-sulfamoyl-5,6,7,8-tetrahydronaphthalene-2-carboxylic acid. InChIKey: GFMSETFIZOSQQW-UHFFFAOYSA-N.
| Molecular formula | C11H13NO4S |
|---|---|
| Molecular weight | 255.29 g/mol |
| IUPAC name | 4-sulfamoyl-5,6,7,8-tetrahydronaphthalene-2-carboxylic acid |
| InChIKey | GFMSETFIZOSQQW-UHFFFAOYSA-N |
| SMILES | C1CCC2=C(C1)C=C(C=C2S(=O)(=O)N)C(=O)O |
Computed by PubChem (NCBI)