CAS 926234-11-9 appears in our catalog under these names: 3-(3-Methylphenyl)-2,4-dioxo-1,2,3,4-tetrahydroquinazoline-7-carboxylic acid, 95%, 3-(3-Methylphenyl)-2,4-dioxo-1,2,3,4-tetrahydroquinazoline-7-carboxylic acid. Offered by: AmBeed, Biosynth. Available pack sizes: 5g, 100mg, 1g.
3-(3-methylphenyl)-2,4-dioxo-1H-quinazoline-7-carboxylic acid (CAS 926234-11-9) is a chemical compound with the molecular formula C16H12N2O4 and a molecular weight of 296.28 g/mol. IUPAC name: 3-(3-methylphenyl)-2,4-dioxo-1H-quinazoline-7-carboxylic acid. InChIKey: QXCDMASIUVHDFY-UHFFFAOYSA-N.
| Molecular formula | C16H12N2O4 |
|---|---|
| Molecular weight | 296.28 g/mol |
| IUPAC name | 3-(3-methylphenyl)-2,4-dioxo-1H-quinazoline-7-carboxylic acid |
| InChIKey | QXCDMASIUVHDFY-UHFFFAOYSA-N |
| SMILES | CC1=CC(=CC=C1)N2C(=O)C3=C(C=C(C=C3)C(=O)O)NC2=O |
Computed by PubChem (NCBI)