Products 926258-28-8
CAS 926258-28-8 is the registry number for 2-(Chlorosulfonyl)-3-methylbenzoic acid, 95%. Offered by: Ambeed, BLDpharm. Available pack sizes: 100mg, 250mg, 1g, 50mg.
2-chlorosulfonyl-3-methylbenzoic acid (CAS 926258-28-8) is a chemical compound with the molecular formula C8H7ClO4S and a molecular weight of 234.66 g/mol. IUPAC name: 2-chlorosulfonyl-3-methylbenzoic acid. InChIKey: BVYUGAYNRYPWOK-UHFFFAOYSA-N.
| Molecular formula | C8H7ClO4S |
|---|---|
| Molecular weight | 234.66 g/mol |
| IUPAC name | 2-chlorosulfonyl-3-methylbenzoic acid |
| InChIKey | BVYUGAYNRYPWOK-UHFFFAOYSA-N |
| SMILES | CC1=C(C(=CC=C1)C(=O)O)S(=O)(=O)Cl |
Computed by PubChem (NCBI)