Products 926270-12-4
CAS 926270-12-4 appears in our catalog under these names: 2-(2-Chloro-4-cyanophenoxy)acetic acid, 2-(2-Chloro-4-cyanophenoxy)acetic acid 95%. Offered by: Biosynth, Ambeed. Available pack sizes: 100mg, 1g, 250mg, 5g.
2-(2-chloro-4-cyanophenoxy)acetic acid (CAS 926270-12-4) is a chemical compound with the molecular formula C9H6ClNO3 and a molecular weight of 211.60 g/mol. IUPAC name: 2-(2-chloro-4-cyanophenoxy)acetic acid. InChIKey: JJLWMGQTXIYABP-UHFFFAOYSA-N.
| Molecular formula | C9H6ClNO3 |
|---|---|
| Molecular weight | 211.60 g/mol |
| IUPAC name | 2-(2-chloro-4-cyanophenoxy)acetic acid |
| InChIKey | JJLWMGQTXIYABP-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1C#N)Cl)OCC(=O)O |
Computed by PubChem (NCBI)