CAS 926667-78-9 appears in our catalog under these names: Racemic-(1r,2r)-2'-oxospiro[cyclopropane-1,3'-indoline]-2-carboxylic acid, 95%, (1R,2R)–2'–Oxospiro(cyclopropane–1,3'–indoline)–2–carboxylic acid. Offered by: Combi-blocks, GLPBio. Available pack sizes: 5g, 1g, 250mg, 100mg.
(1'R,3R)-2-oxospiro[1H-indole-3,2'-cyclopropane]-1'-carboxylic acid (CAS 926667-78-9) is a chemical compound with the molecular formula C11H9NO3 and a molecular weight of 203.19 g/mol. IUPAC name: (1'R,3R)-2-oxospiro[1H-indole-3,2'-cyclopropane]-1'-carboxylic acid. InChIKey: WQBMGVVIMKVWJT-CPCISQLKSA-N.
| Molecular formula | C11H9NO3 |
|---|---|
| Molecular weight | 203.19 g/mol |
| IUPAC name | (1'R,3R)-2-oxospiro[1H-indole-3,2'-cyclopropane]-1'-carboxylic acid |
| InChIKey | WQBMGVVIMKVWJT-CPCISQLKSA-N |
| SMILES | C1[C@H]([C@@]12C3=CC=CC=C3NC2=O)C(=O)O |
Computed by PubChem (NCBI)