CAS 927802-05-9 appears in our catalog under these names: 1-(3-Chloro-4-methoxyphenyl)-2-hydroxyethan-1-one, 95%, 1-(3-Chloro-4-methoxyphenyl)-2-hydroxyethan-1-one. Offered by: AmBeed, Biosynth. Available pack sizes: 1g, 50mg, 0,5g.
1-(3-chloro-4-methoxyphenyl)-2-hydroxyethanone (CAS 927802-05-9) is a chemical compound with the molecular formula C9H9ClO3 and a molecular weight of 200.62 g/mol. IUPAC name: 1-(3-chloro-4-methoxyphenyl)-2-hydroxyethanone. InChIKey: OEGWXGIQCWTOPY-UHFFFAOYSA-N.
| Molecular formula | C9H9ClO3 |
|---|---|
| Molecular weight | 200.62 g/mol |
| IUPAC name | 1-(3-chloro-4-methoxyphenyl)-2-hydroxyethanone |
| InChIKey | OEGWXGIQCWTOPY-UHFFFAOYSA-N |
| SMILES | COC1=C(C=C(C=C1)C(=O)CO)Cl |
Computed by PubChem (NCBI)