Products 92864-26-1
CAS 92864-26-1 is the registry number for 3,3-Dimethyl-5-(4-methylphenyl)-5-oxopentanoic acid. Offered by: Biosynth. Available pack sizes: 1g, 100mg.
3,3-dimethyl-5-(4-methylphenyl)-5-oxopentanoic acid (CAS 92864-26-1) is a chemical compound with the molecular formula C14H18O3 and a molecular weight of 234.29 g/mol. IUPAC name: 3,3-dimethyl-5-(4-methylphenyl)-5-oxopentanoic acid. InChIKey: SXQQAMZUOYVYAM-UHFFFAOYSA-N.
| Molecular formula | C14H18O3 |
|---|---|
| Molecular weight | 234.29 g/mol |
| IUPAC name | 3,3-dimethyl-5-(4-methylphenyl)-5-oxopentanoic acid |
| InChIKey | SXQQAMZUOYVYAM-UHFFFAOYSA-N |
| SMILES | CC1=CC=C(C=C1)C(=O)CC(C)(C)CC(=O)O |
Computed by PubChem (NCBI)