Products 929202-79-9
CAS 929202-79-9 is the registry number for Antibacterial agent 279. Offered by: MedChemExpress. Available pack sizes: Get quote.
3-(2-sulfanylanilino)propanoic acid (CAS 929202-79-9) is a chemical compound with the molecular formula C9H11NO2S and a molecular weight of 197.26 g/mol. IUPAC name: 3-(2-sulfanylanilino)propanoic acid. InChIKey: BYMYDMUTFXOAJN-UHFFFAOYSA-N.
| Molecular formula | C9H11NO2S |
|---|---|
| Molecular weight | 197.26 g/mol |
| IUPAC name | 3-(2-sulfanylanilino)propanoic acid |
| InChIKey | BYMYDMUTFXOAJN-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C(=C1)NCCC(=O)O)S |
Computed by PubChem (NCBI)
Synonyms:
orb3027627, N-(2-mercaptophenyl)-beta-alanine