Products 92959-73-4
CAS 92959-73-4 is the registry number for Acetamide, N-[4-[2-(acetyloxy)ethyl]-2-nitrophenyl]-, ≥95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g, 10g.
2-(4-acetamido-3-nitrophenyl)ethyl acetate (CAS 92959-73-4) is a chemical compound with the molecular formula C12H14N2O5 and a molecular weight of 266.25 g/mol. IUPAC name: 2-(4-acetamido-3-nitrophenyl)ethyl acetate. InChIKey: DICCMIHFJLGGDB-UHFFFAOYSA-N.
| Molecular formula | C12H14N2O5 |
|---|---|
| Molecular weight | 266.25 g/mol |
| IUPAC name | 2-(4-acetamido-3-nitrophenyl)ethyl acetate |
| InChIKey | DICCMIHFJLGGDB-UHFFFAOYSA-N |
| SMILES | CC(=O)NC1=C(C=C(C=C1)CCOC(=O)C)[N+](=O)[O-] |
Computed by PubChem (NCBI)