CAS 929642-56-8 appears in our catalog under these names: (S)-2,2,2-Trifluoro-1-(4-methoxyphenyl)ethanamine hydrochloride, 98%, (S)-2,2,2-Trifluoro-1-(4-methoxyphenyl)ethanamine hydrochloride, 97%, 97%, (S)-2,2,2-TRIFLUORO-1-(4-METHOXYPHENYL)ETHANAMINE HCL, 97%. Offered by: AmBeed, Chemat, Fluorochem. Available pack sizes: 1g, 100mg, 250mg.
(1S)-2,2,2-trifluoro-1-(4-methoxyphenyl)ethanamine;hydrochloride (CAS 929642-56-8) is a chemical compound with the molecular formula C9H11ClF3NO and a molecular weight of 241.64 g/mol. IUPAC name: (1S)-2,2,2-trifluoro-1-(4-methoxyphenyl)ethanamine;hydrochloride. InChIKey: DNCUAEBPHZKGHO-QRPNPIFTSA-N.
| Molecular formula | C9H11ClF3NO |
|---|---|
| Molecular weight | 241.64 g/mol |
| IUPAC name | (1S)-2,2,2-trifluoro-1-(4-methoxyphenyl)ethanamine;hydrochloride |
| InChIKey | DNCUAEBPHZKGHO-QRPNPIFTSA-N |
| SMILES | COC1=CC=C(C=C1)[C@@H](C(F)(F)F)N.Cl |
Computed by PubChem (NCBI)