Products 929709-59-1
CAS 929709-59-1 appears in our catalog under these names: 4-Hydroxy-3-nitrophenylacetic Acid-d5 (Major), >95% (HPLC), 4-Hydroxy-3-nitrophenylacetic acid-d5. Offered by: TRC, MedChemExpress. Available pack sizes: 10mg, 10 mg.
2,2-dideuterio-2-(2,3,6-trideuterio-4-hydroxy-5-nitrophenyl)acetic acid (CAS 929709-59-1) is a chemical compound with the molecular formula C8H7NO5 and a molecular weight of 202.18 g/mol. IUPAC name: 2,2-dideuterio-2-(2,3,6-trideuterio-4-hydroxy-5-nitrophenyl)acetic acid. InChIKey: QBHBHOSRLDPIHG-QUWGTZMWSA-N.
| Molecular formula | C8H7NO5 |
|---|---|
| Molecular weight | 202.18 g/mol |
| IUPAC name | 2,2-dideuterio-2-(2,3,6-trideuterio-4-hydroxy-5-nitrophenyl)acetic acid |
| InChIKey | QBHBHOSRLDPIHG-QUWGTZMWSA-N |
| SMILES | [2H]C1=C(C(=C(C(=C1C([2H])([2H])C(=O)O)[2H])[N+](=O)[O-])O)[2H] |
Computed by PubChem (NCBI)