Products 929881-46-9
CAS 929881-46-9 appears in our catalog under these names: Cucumegastigmane I, Cucumegastigmane I, 98.0%. Offered by: TargetMol, MedChemExpress, Chemat. Available pack sizes: 5mg, Get quote.
(4S)-4-[(E,3S)-3,4-dihydroxybut-1-enyl]-4-hydroxy-3,5,5-trimethylcyclohex-2-en-1-one (CAS 929881-46-9) is a chemical compound with the molecular formula C13H20O4 and a molecular weight of 240.29 g/mol. IUPAC name: (4S)-4-[(E,3S)-3,4-dihydroxybut-1-enyl]-4-hydroxy-3,5,5-trimethylcyclohex-2-en-1-one. InChIKey: CNLCQYMRNGWEJB-OERKHBLVSA-N.
| Molecular formula | C13H20O4 |
|---|---|
| Molecular weight | 240.29 g/mol |
| IUPAC name | (4S)-4-[(E,3S)-3,4-dihydroxybut-1-enyl]-4-hydroxy-3,5,5-trimethylcyclohex-2-en-1-one |
| InChIKey | CNLCQYMRNGWEJB-OERKHBLVSA-N |
| SMILES | CC1=CC(=O)CC([C@]1(/C=C/[C@@H](CO)O)O)(C)C |
Computed by PubChem (NCBI)
Synonyms:
Cucumegastigmane I, orb1681396