CAS 929971-95-9 appears in our catalog under these names: 6,7-Dimethoxycinnoline-3-carboxylic acid, 98%, 6,7-Dimethoxycinnoline-3-carboxylic acid. Offered by: AmBeed, Biosynth. Available pack sizes: 10g, 5g, 1g, 0,5g, 50mg.
6,7-dimethoxycinnoline-3-carboxylic acid (CAS 929971-95-9) is a chemical compound with the molecular formula C11H10N2O4 and a molecular weight of 234.21 g/mol. IUPAC name: 6,7-dimethoxycinnoline-3-carboxylic acid. InChIKey: PBTKNSLLXQBHGG-UHFFFAOYSA-N.
| Molecular formula | C11H10N2O4 |
|---|---|
| Molecular weight | 234.21 g/mol |
| IUPAC name | 6,7-dimethoxycinnoline-3-carboxylic acid |
| InChIKey | PBTKNSLLXQBHGG-UHFFFAOYSA-N |
| SMILES | COC1=C(C=C2C(=C1)C=C(N=N2)C(=O)O)OC |
Computed by PubChem (NCBI)