CAS 929973-67-1 appears in our catalog under these names: 2-Chloro-n-(2-methoxy-5-methylphenyl)propanamide, 95%, N-(2-Methoxy-5-methylphenyl)-2-chloropropanamide. Offered by: Combi-blocks, Biosynth. Available pack sizes: 10g, 5g, 1g, 5000mg.
2-chloro-N-(2-methoxy-5-methylphenyl)propanamide (CAS 929973-67-1) is a chemical compound with the molecular formula C11H14ClNO2 and a molecular weight of 227.69 g/mol. IUPAC name: 2-chloro-N-(2-methoxy-5-methylphenyl)propanamide. InChIKey: PTWOSQAFEUCGDT-UHFFFAOYSA-N.
| Molecular formula | C11H14ClNO2 |
|---|---|
| Molecular weight | 227.69 g/mol |
| IUPAC name | 2-chloro-N-(2-methoxy-5-methylphenyl)propanamide |
| InChIKey | PTWOSQAFEUCGDT-UHFFFAOYSA-N |
| SMILES | CC1=CC(=C(C=C1)OC)NC(=O)C(C)Cl |
Computed by PubChem (NCBI)