CAS 929974-88-9 is the registry number for 3-((2,5-Dioxoimidazolidin-1-yl)methyl)benzoic acid, 95%. Offered by: AmBeed. Available pack sizes: 5g.
3-[(2,5-dioxoimidazolidin-1-yl)methyl]benzoic acid (CAS 929974-88-9) is a chemical compound with the molecular formula C11H10N2O4 and a molecular weight of 234.21 g/mol. IUPAC name: 3-[(2,5-dioxoimidazolidin-1-yl)methyl]benzoic acid. InChIKey: CYEBFTIDIADYDZ-UHFFFAOYSA-N.
| Molecular formula | C11H10N2O4 |
|---|---|
| Molecular weight | 234.21 g/mol |
| IUPAC name | 3-[(2,5-dioxoimidazolidin-1-yl)methyl]benzoic acid |
| InChIKey | CYEBFTIDIADYDZ-UHFFFAOYSA-N |
| SMILES | C1C(=O)N(C(=O)N1)CC2=CC(=CC=C2)C(=O)O |
Computed by PubChem (NCBI)