CAS 929975-03-1 is the registry number for 3-({8-methylimidazo(1,2-a)pyridin-2-yl}methoxy)benzoic acid, 95%. Offered by: AmBeed. Available pack sizes: 5g.
3-[(8-methylimidazo[1,2-a]pyridin-2-yl)methoxy]benzoic acid (CAS 929975-03-1) is a chemical compound with the molecular formula C16H14N2O3 and a molecular weight of 282.29 g/mol. IUPAC name: 3-[(8-methylimidazo[1,2-a]pyridin-2-yl)methoxy]benzoic acid. InChIKey: XONVDGWYZQGQEQ-UHFFFAOYSA-N.
| Molecular formula | C16H14N2O3 |
|---|---|
| Molecular weight | 282.29 g/mol |
| IUPAC name | 3-[(8-methylimidazo[1,2-a]pyridin-2-yl)methoxy]benzoic acid |
| InChIKey | XONVDGWYZQGQEQ-UHFFFAOYSA-N |
| SMILES | CC1=CC=CN2C1=NC(=C2)COC3=CC=CC(=C3)C(=O)O |
Computed by PubChem (NCBI)