CAS 929975-20-2 is the registry number for 5,7-Dimethoxycinnoline-3-carboxylic acid, 97%. Offered by: AmBeed. Available pack sizes: 1g, 10g, 5g.
5,7-dimethoxycinnoline-3-carboxylic acid (CAS 929975-20-2) is a chemical compound with the molecular formula C11H10N2O4 and a molecular weight of 234.21 g/mol. IUPAC name: 5,7-dimethoxycinnoline-3-carboxylic acid. InChIKey: NSCWKRULMBQTRF-UHFFFAOYSA-N.
| Molecular formula | C11H10N2O4 |
|---|---|
| Molecular weight | 234.21 g/mol |
| IUPAC name | 5,7-dimethoxycinnoline-3-carboxylic acid |
| InChIKey | NSCWKRULMBQTRF-UHFFFAOYSA-N |
| SMILES | COC1=CC2=NN=C(C=C2C(=C1)OC)C(=O)O |
Computed by PubChem (NCBI)