CAS 929975-51-9 appears in our catalog under these names: 1-{5-methyl-(1,2,4)triazolo(4,3-a)pyrimidin-6-yl}ethan-1-one, 95%, 1-{5-Methyl-(1,2,4)triazolo(4,3-a)pyrimidin-6-yl}ethan-1-one. Offered by: AmBeed, Biosynth. Available pack sizes: 5g, 2,5g, 250mg.
1-(5-methyl-[1,2,4]triazolo[4,3-a]pyrimidin-6-yl)ethanone (CAS 929975-51-9) is a chemical compound with the molecular formula C8H8N4O and a molecular weight of 176.18 g/mol. IUPAC name: 1-(5-methyl-[1,2,4]triazolo[4,3-a]pyrimidin-6-yl)ethanone. InChIKey: MKHZAMWKHLTPHC-UHFFFAOYSA-N.
| Molecular formula | C8H8N4O |
|---|---|
| Molecular weight | 176.18 g/mol |
| IUPAC name | 1-(5-methyl-[1,2,4]triazolo[4,3-a]pyrimidin-6-yl)ethanone |
| InChIKey | MKHZAMWKHLTPHC-UHFFFAOYSA-N |
| SMILES | CC1=C(C=NC2=NN=CN12)C(=O)C |
Computed by PubChem (NCBI)