CAS 93073-40-6 appears in our catalog under these names: 5-(2-Phenylethyl)-1,3,4-oxadiazole-2-thiol, 95%, 5-(2-Phenylethyl)-1,3,4-oxadiazole-2-thiol. Offered by: AmBeed, Biosynth. Available pack sizes: 5g, 100mg, 1g.
5-(2-phenylethyl)-3H-1,3,4-oxadiazole-2-thione (CAS 93073-40-6) is a chemical compound with the molecular formula C10H10N2OS and a molecular weight of 206.27 g/mol. IUPAC name: 5-(2-phenylethyl)-3H-1,3,4-oxadiazole-2-thione. InChIKey: LWFLSIYQAROQEJ-UHFFFAOYSA-N.
| Molecular formula | C10H10N2OS |
|---|---|
| Molecular weight | 206.27 g/mol |
| IUPAC name | 5-(2-phenylethyl)-3H-1,3,4-oxadiazole-2-thione |
| InChIKey | LWFLSIYQAROQEJ-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)CCC2=NNC(=S)O2 |
Computed by PubChem (NCBI)