Products 93198-70-0

CAS 93198-70-0 is the registry number for Methyl 2,3-Dihydrobenzofuran-3-Acetate. Offered by: Chemat Brand, TRC. Available pack sizes: on request, 250mg.

Structural formula: {0} (CAS {1})

Methyl 2-(2,3-dihydro-1-benzofuran-3-yl)acetate (CAS 93198-70-0) is a chemical compound with the molecular formula C11H12O3 and a molecular weight of 192.21 g/mol. IUPAC name: methyl 2-(2,3-dihydro-1-benzofuran-3-yl)acetate. InChIKey: WNGCZYQQAUAZIQ-UHFFFAOYSA-N.

Identity
Molecular formulaC11H12O3
Molecular weight192.21 g/mol
IUPAC namemethyl 2-(2,3-dihydro-1-benzofuran-3-yl)acetate
InChIKeyWNGCZYQQAUAZIQ-UHFFFAOYSA-N
SMILESCOC(=O)CC1COC2=CC=CC=C12

Computed by PubChem (NCBI)