Products 932041-14-0
CAS 932041-14-0 appears in our catalog under these names: Methyl 4-chloro-1H-indazole-3-carboxylate, 98%, 1H-Indazole-3-carboxylic acid, 4-chloro-, methyl ester, 98%. Offered by: Fluorochem, Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g.
Methyl 4-chloro-1H-indazole-3-carboxylate (CAS 932041-14-0) is a chemical compound with the molecular formula C9H7ClN2O2 and a molecular weight of 210.62 g/mol. IUPAC name: methyl 4-chloro-1H-indazole-3-carboxylate. InChIKey: ZTEHEVOAKFIDDI-UHFFFAOYSA-N.
| Molecular formula | C9H7ClN2O2 |
|---|---|
| Molecular weight | 210.62 g/mol |
| IUPAC name | methyl 4-chloro-1H-indazole-3-carboxylate |
| InChIKey | ZTEHEVOAKFIDDI-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=NNC2=C1C(=CC=C2)Cl |
Computed by PubChem (NCBI)