Products 933060-65-2

CAS 933060-65-2 is the registry number for 1-(Furan-2-carbonyl)pyrrolidine-2-carboxylic acid. Offered by: Biosynth. Available pack sizes: 5g, 0,5g.

Structural formula: {0} (CAS {1})

1-(furan-2-carbonyl)pyrrolidine-2-carboxylic acid (CAS 933060-65-2) is a chemical compound with the molecular formula C10H11NO4 and a molecular weight of 209.20 g/mol. IUPAC name: 1-(furan-2-carbonyl)pyrrolidine-2-carboxylic acid. InChIKey: HVKHSTWTJLFRBZ-UHFFFAOYSA-N.

Identity
Molecular formulaC10H11NO4
Molecular weight209.20 g/mol
IUPAC name1-(furan-2-carbonyl)pyrrolidine-2-carboxylic acid
InChIKeyHVKHSTWTJLFRBZ-UHFFFAOYSA-N
SMILESC1CC(N(C1)C(=O)C2=CC=CO2)C(=O)O

Computed by PubChem (NCBI)