CAS 93316-40-6 is the registry number for 2-Benzoyl-1,2,3,4-tetrahydro-isoquinoline-3-carboxylic acid, 96%. Offered by: Combi-blocks. Available pack sizes: 1g, 250mg, 5g.
2-benzoyl-3,4-dihydro-1H-isoquinoline-3-carboxylic acid (CAS 93316-40-6) is a chemical compound with the molecular formula C17H15NO3 and a molecular weight of 281.30 g/mol. IUPAC name: 2-benzoyl-3,4-dihydro-1H-isoquinoline-3-carboxylic acid. InChIKey: QBBPKILWLZTVIC-UHFFFAOYSA-N.
| Molecular formula | C17H15NO3 |
|---|---|
| Molecular weight | 281.30 g/mol |
| IUPAC name | 2-benzoyl-3,4-dihydro-1H-isoquinoline-3-carboxylic acid |
| InChIKey | QBBPKILWLZTVIC-UHFFFAOYSA-N |
| SMILES | C1C(N(CC2=CC=CC=C21)C(=O)C3=CC=CC=C3)C(=O)O |
Computed by PubChem (NCBI)