Products 93316-40-6

CAS 93316-40-6 is the registry number for 2-Benzoyl-1,2,3,4-tetrahydro-isoquinoline-3-carboxylic acid, 96%. Offered by: Combi-blocks. Available pack sizes: 1g, 250mg, 5g.

Structural formula: {0} (CAS {1})

2-benzoyl-3,4-dihydro-1H-isoquinoline-3-carboxylic acid (CAS 93316-40-6) is a chemical compound with the molecular formula C17H15NO3 and a molecular weight of 281.30 g/mol. IUPAC name: 2-benzoyl-3,4-dihydro-1H-isoquinoline-3-carboxylic acid. InChIKey: QBBPKILWLZTVIC-UHFFFAOYSA-N.

Identity
Molecular formulaC17H15NO3
Molecular weight281.30 g/mol
IUPAC name2-benzoyl-3,4-dihydro-1H-isoquinoline-3-carboxylic acid
InChIKeyQBBPKILWLZTVIC-UHFFFAOYSA-N
SMILESC1C(N(CC2=CC=CC=C21)C(=O)C3=CC=CC=C3)C(=O)O

Computed by PubChem (NCBI)