CAS 933671-86-4 appears in our catalog under these names: 4-Bromo-3-ethoxybenzoic acid, 95%, 4-Bromo-3-ethoxybenzoic acid 98%, 4-Bromo-3-ethoxybenzoic acid, 98%, 4-bromo-3-ethoxybenzoic acid, 98%, 98%. Offered by: Combi-blocks, Ambeed, Fluorochem, Chemat. Available pack sizes: 1g, 250mg, 100mg, 500mg, 5g, 10g.
4-bromo-3-ethoxybenzoic acid (CAS 933671-86-4) is a chemical compound with the molecular formula C9H9BrO3 and a molecular weight of 245.07 g/mol. IUPAC name: 4-bromo-3-ethoxybenzoic acid. InChIKey: KTBJPOSCZHJGRM-UHFFFAOYSA-N.
| Molecular formula | C9H9BrO3 |
|---|---|
| Molecular weight | 245.07 g/mol |
| IUPAC name | 4-bromo-3-ethoxybenzoic acid |
| InChIKey | KTBJPOSCZHJGRM-UHFFFAOYSA-N |
| SMILES | CCOC1=C(C=CC(=C1)C(=O)O)Br |
Computed by PubChem (NCBI)