Products 933694-01-0
CAS 933694-01-0 appears in our catalog under these names: 7-Chloro-1,8-naphthyridine-3-carboxylic acid, 95%, 7-Chloro-1,8-naphthyridine-3-carboxylic acid. Offered by: AmBeed, Biosynth. Available pack sizes: 250mg, 1g, 0,5g, 50mg.
7-chloro-1,8-naphthyridine-3-carboxylic acid (CAS 933694-01-0) is a chemical compound with the molecular formula C9H5ClN2O2 and a molecular weight of 208.60 g/mol. IUPAC name: 7-chloro-1,8-naphthyridine-3-carboxylic acid. InChIKey: GQTPFDBSQAIPOT-UHFFFAOYSA-N.
| Molecular formula | C9H5ClN2O2 |
|---|---|
| Molecular weight | 208.60 g/mol |
| IUPAC name | 7-chloro-1,8-naphthyridine-3-carboxylic acid |
| InChIKey | GQTPFDBSQAIPOT-UHFFFAOYSA-N |
| SMILES | C1=CC(=NC2=NC=C(C=C21)C(=O)O)Cl |
Computed by PubChem (NCBI)