Products 933731-71-6
CAS 933731-71-6 appears in our catalog under these names: 1-(4-Fluorophenyl)pyrrolidine-3-carboxylic acid, 96%, 1-(4-Fluorophenyl)pyrrolidine-3-carboxylic acid, 95+%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 1g, 100mg, 250mg.
1-(4-fluorophenyl)pyrrolidine-3-carboxylic acid (CAS 933731-71-6) is a chemical compound with the molecular formula C11H12FNO2 and a molecular weight of 209.22 g/mol. IUPAC name: 1-(4-fluorophenyl)pyrrolidine-3-carboxylic acid. InChIKey: YJGOVCVVOBKAOW-UHFFFAOYSA-N.
| Molecular formula | C11H12FNO2 |
|---|---|
| Molecular weight | 209.22 g/mol |
| IUPAC name | 1-(4-fluorophenyl)pyrrolidine-3-carboxylic acid |
| InChIKey | YJGOVCVVOBKAOW-UHFFFAOYSA-N |
| SMILES | C1CN(CC1C(=O)O)C2=CC=C(C=C2)F |
Computed by PubChem (NCBI)