Products 934188-80-4
CAS 934188-80-4 appears in our catalog under these names: Ethyl 5-(2,4-difluorophenyl)-1,2-oxazole-3-carboxylate, ETHYL 5-(2,4-DIFLUOROPHENYL)-1,2-OXAZOLE-3-CARBOXYLATE, 98%. Offered by: Biosynth, Chemat. Available pack sizes: 1g, 100mg, 250mg.
Ethyl 5-(2,4-difluorophenyl)-1,2-oxazole-3-carboxylate (CAS 934188-80-4) is a chemical compound with the molecular formula C12H9F2NO3 and a molecular weight of 253.20 g/mol. IUPAC name: ethyl 5-(2,4-difluorophenyl)-1,2-oxazole-3-carboxylate. InChIKey: WYJPRVBFXLXFRG-UHFFFAOYSA-N.
| Molecular formula | C12H9F2NO3 |
|---|---|
| Molecular weight | 253.20 g/mol |
| IUPAC name | ethyl 5-(2,4-difluorophenyl)-1,2-oxazole-3-carboxylate |
| InChIKey | WYJPRVBFXLXFRG-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C1=NOC(=C1)C2=C(C=C(C=C2)F)F |
Computed by PubChem (NCBI)