Products 934740-42-8
CAS 934740-42-8 is the registry number for (3S,4R)-4-Hydroxy-5-oxo-4-phenyl-1-((R)-1-phenylethyl)pyrrolidine-3-carboxylic acid, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
(3S,4R)-4-hydroxy-5-oxo-4-phenyl-1-[(1R)-1-phenylethyl]pyrrolidine-3-carboxylic acid (CAS 934740-42-8) is a chemical compound with the molecular formula C19H19NO4 and a molecular weight of 325.4 g/mol. IUPAC name: (3S,4R)-4-hydroxy-5-oxo-4-phenyl-1-[(1R)-1-phenylethyl]pyrrolidine-3-carboxylic acid. InChIKey: ASNRKIOWONRMSM-NRXGSXMXSA-N.
| Molecular formula | C19H19NO4 |
|---|---|
| Molecular weight | 325.4 g/mol |
| IUPAC name | (3S,4R)-4-hydroxy-5-oxo-4-phenyl-1-[(1R)-1-phenylethyl]pyrrolidine-3-carboxylic acid |
| InChIKey | ASNRKIOWONRMSM-NRXGSXMXSA-N |
| SMILES | C[C@H](C1=CC=CC=C1)N2C[C@@H]([C@](C2=O)(C3=CC=CC=C3)O)C(=O)O |
Computed by PubChem (NCBI)