Products 934993-58-5
CAS 934993-58-5 appears in our catalog under these names: 7-Bromo-2,2-dimethyl-2h-1,4-benzoxazin-3(4h)-one, 95%, 7-Bromo-2,2-dimethyl-2H-benzo(b)(1,4)oxazin-3(4H)-one, 7-Bromo-2,2-dimethyl-2H-benzo[b][1,4]oxazin-3(4H)-one, 97%, 97%, 7-BROMO-2,2-DIMETHYL-2H-BENZO[B][1,4]OXAZIN-3(4H)-ONE, 95%, 7-Bromo-2,2-dimethyl-2H-benzo[b][1,4]oxazin-3(4H)-one, 97%. Offered by: Combi-blocks, Biosynth, Chemat, Fluorochem, Ambeed. Available pack sizes: 250mg, 1g, 5g, 100mg.
7-bromo-2,2-dimethyl-4H-1,4-benzoxazin-3-one (CAS 934993-58-5) is a chemical compound with the molecular formula C10H10BrNO2 and a molecular weight of 256.10 g/mol. IUPAC name: 7-bromo-2,2-dimethyl-4H-1,4-benzoxazin-3-one. InChIKey: SZPRSMJCVKHIIX-UHFFFAOYSA-N.
| Molecular formula | C10H10BrNO2 |
|---|---|
| Molecular weight | 256.10 g/mol |
| IUPAC name | 7-bromo-2,2-dimethyl-4H-1,4-benzoxazin-3-one |
| InChIKey | SZPRSMJCVKHIIX-UHFFFAOYSA-N |
| SMILES | CC1(C(=O)NC2=C(O1)C=C(C=C2)Br)C |
Computed by PubChem (NCBI)