Products 935847-86-2

CAS 935847-86-2 is the registry number for 2-(Methylthio)phenyl carbonochloridate, 98%. Offered by: Chemat Brand. Available pack sizes: on request.

Structural formula: {0} (CAS {1})

(2-methylsulfanylphenyl) carbonochloridate (CAS 935847-86-2) is a chemical compound with the molecular formula C8H7ClO2S and a molecular weight of 202.66 g/mol. IUPAC name: (2-methylsulfanylphenyl) carbonochloridate. InChIKey: PUYHEFHKBCIMGG-UHFFFAOYSA-N.

Identity
Molecular formulaC8H7ClO2S
Molecular weight202.66 g/mol
IUPAC name(2-methylsulfanylphenyl) carbonochloridate
InChIKeyPUYHEFHKBCIMGG-UHFFFAOYSA-N
SMILESCSC1=CC=CC=C1OC(=O)Cl

Computed by PubChem (NCBI)