Products 936006-11-0
CAS 936006-11-0 appears in our catalog under these names: 5-(6-Hydroxybenzofuran-2-yl)-2-(3-methylbut-1-enyl)benzene-1,3-diol, Artoindonesianin B 1. Offered by: Biosynth, MedChemExpress. Available pack sizes: 10mg, 5mg, 25mg, 50mg, Get quote.
5-(6-hydroxy-1-benzofuran-2-yl)-2-[(E)-3-methylbut-1-enyl]benzene-1,3-diol (CAS 936006-11-0) is a chemical compound with the molecular formula C19H18O4 and a molecular weight of 310.3 g/mol. IUPAC name: 5-(6-hydroxy-1-benzofuran-2-yl)-2-[(E)-3-methylbut-1-enyl]benzene-1,3-diol. InChIKey: YVWWLJFWZOKLLA-ZZXKWVIFSA-N.
| Molecular formula | C19H18O4 |
|---|---|
| Molecular weight | 310.3 g/mol |
| IUPAC name | 5-(6-hydroxy-1-benzofuran-2-yl)-2-[(E)-3-methylbut-1-enyl]benzene-1,3-diol |
| InChIKey | YVWWLJFWZOKLLA-ZZXKWVIFSA-N |
| SMILES | CC(C)/C=C/C1=C(C=C(C=C1O)C2=CC3=C(O2)C=C(C=C3)O)O |
Computed by PubChem (NCBI)