CAS 93629-82-4 appears in our catalog under these names: N-(4-((4-Hydroxyphenyl)amino)phenyl)acetamide, >95% (HPLC), Acetaminophen Impurity 39. Offered by: TRC, Chemat Brand. Available pack sizes: 100mg, 1g, on request.
N-[4-(4-hydroxyanilino)phenyl]acetamide (CAS 93629-82-4) is a chemical compound with the molecular formula C14H14N2O2 and a molecular weight of 242.27 g/mol. IUPAC name: N-[4-(4-hydroxyanilino)phenyl]acetamide. InChIKey: GBRJDIQXAKADHR-UHFFFAOYSA-N.
| Molecular formula | C14H14N2O2 |
|---|---|
| Molecular weight | 242.27 g/mol |
| IUPAC name | N-[4-(4-hydroxyanilino)phenyl]acetamide |
| InChIKey | GBRJDIQXAKADHR-UHFFFAOYSA-N |
| SMILES | CC(=O)NC1=CC=C(C=C1)NC2=CC=C(C=C2)O |
Computed by PubChem (NCBI)