CAS 937046-99-6 is the registry number for 2-Benzyl-6-bromo-2H-indazole, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
2-benzyl-6-bromoindazole (CAS 937046-99-6) is a chemical compound with the molecular formula C14H11BrN2 and a molecular weight of 287.15 g/mol. IUPAC name: 2-benzyl-6-bromoindazole. InChIKey: YKUZHOWZFPJKPO-UHFFFAOYSA-N.
| Molecular formula | C14H11BrN2 |
|---|---|
| Molecular weight | 287.15 g/mol |
| IUPAC name | 2-benzyl-6-bromoindazole |
| InChIKey | YKUZHOWZFPJKPO-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)CN2C=C3C=CC(=CC3=N2)Br |
Computed by PubChem (NCBI)