Products 93709-67-2
CAS 93709-67-2 is the registry number for (2S)-2-((3,4,5-Trimethoxyphenyl)formamido)propanoic acid. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.
(2S)-2-[(3,4,5-trimethoxybenzoyl)amino]propanoic acid (CAS 93709-67-2) is a chemical compound with the molecular formula C13H17NO6 and a molecular weight of 283.28 g/mol. IUPAC name: (2S)-2-[(3,4,5-trimethoxybenzoyl)amino]propanoic acid. InChIKey: LYDVPBQLBMIUQN-ZETCQYMHSA-N.
| Molecular formula | C13H17NO6 |
|---|---|
| Molecular weight | 283.28 g/mol |
| IUPAC name | (2S)-2-[(3,4,5-trimethoxybenzoyl)amino]propanoic acid |
| InChIKey | LYDVPBQLBMIUQN-ZETCQYMHSA-N |
| SMILES | C[C@@H](C(=O)O)NC(=O)C1=CC(=C(C(=C1)OC)OC)OC |
Computed by PubChem (NCBI)