CAS 937621-97-1 appears in our catalog under these names: (5-BROMO-1H-INDOL-1-YL)ACETIC ACID, 97%, 97%, (5-Bromo-1H-indol-1-yl)acetic acid, 97%, (5-Bromo-1h-indol-1-yl)acetic acid, 95+%, 2-(5-bromo-1H-indol-1-yl)acetic acid. Offered by: Chemat, Combi-blocks, AmBeed, Biosynth, Fluorochem. Available pack sizes: 250mg, 1g, 5g, 10g, 0,5g.
2-(5-bromoindol-1-yl)acetic acid (CAS 937621-97-1) is a chemical compound with the molecular formula C10H8BrNO2 and a molecular weight of 254.08 g/mol. IUPAC name: 2-(5-bromoindol-1-yl)acetic acid. InChIKey: RVDSTBFKTGJQCS-UHFFFAOYSA-N.
| Molecular formula | C10H8BrNO2 |
|---|---|
| Molecular weight | 254.08 g/mol |
| IUPAC name | 2-(5-bromoindol-1-yl)acetic acid |
| InChIKey | RVDSTBFKTGJQCS-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C=CN2CC(=O)O)C=C1Br |
Computed by PubChem (NCBI)