CAS 93794-45-7 appears in our catalog under these names: 5-Chloro-7-methyl-1,3-benzoxazole-2-thiol, 95%, 5-Chloro-7-methyl-1,3-benzoxazole-2-thiol, 5-Chloro-7-methyl-1,3-benzoxazole-2-thiol, 97%, 97%, 5-chloro-7-methyl-2,3-dihydro-1,3-benzoxazole-2-thione, 97%. Offered by: AmBeed, Biosynth, Chemat, Fluorochem. Available pack sizes: 5g, 0,5g, 50mg, 100mg, 250mg, 500mg, 1g, 2.5g.
5-chloro-7-methyl-3H-1,3-benzoxazole-2-thione (CAS 93794-45-7) is a chemical compound with the molecular formula C8H6ClNOS and a molecular weight of 199.66 g/mol. IUPAC name: 5-chloro-7-methyl-3H-1,3-benzoxazole-2-thione. InChIKey: MBALKXWCAQHOJI-UHFFFAOYSA-N.
| Molecular formula | C8H6ClNOS |
|---|---|
| Molecular weight | 199.66 g/mol |
| IUPAC name | 5-chloro-7-methyl-3H-1,3-benzoxazole-2-thione |
| InChIKey | MBALKXWCAQHOJI-UHFFFAOYSA-N |
| SMILES | CC1=CC(=CC2=C1OC(=S)N2)Cl |
Computed by PubChem (NCBI)