CAS 938042-46-7 appears in our catalog under these names: Methyl (3S)-3,4-dihydro-1H-2-benzopyran-3-carboxylate, 95%, Methyl (3S)-3,4-dihydro-1H-2-benzopyran-3-carboxylate. Offered by: AmBeed, Biosynth. Available pack sizes: 1g, 0,5g, 50mg.
Methyl (3S)-3,4-dihydro-1H-isochromene-3-carboxylate (CAS 938042-46-7) is a chemical compound with the molecular formula C11H12O3 and a molecular weight of 192.21 g/mol. IUPAC name: methyl (3S)-3,4-dihydro-1H-isochromene-3-carboxylate. InChIKey: IUKJDSZBRPJUGP-JTQLQIEISA-N.
| Molecular formula | C11H12O3 |
|---|---|
| Molecular weight | 192.21 g/mol |
| IUPAC name | methyl (3S)-3,4-dihydro-1H-isochromene-3-carboxylate |
| InChIKey | IUKJDSZBRPJUGP-JTQLQIEISA-N |
| SMILES | COC(=O)[C@@H]1CC2=CC=CC=C2CO1 |
Computed by PubChem (NCBI)