Products 938116-95-1
CAS 938116-95-1 appears in our catalog under these names: 2-(2,3-Dichlorophenoxy)-2-phenylacetic acid, 95%, 2-(2,3-Dichlorophenoxy)-2-phenylacetic acid. Offered by: AmBeed, Biosynth. Available pack sizes: 5g, 2,5g, 250mg.
2-(2,3-dichlorophenoxy)-2-phenylacetic acid (CAS 938116-95-1) is a chemical compound with the molecular formula C14H10Cl2O3 and a molecular weight of 297.1 g/mol. IUPAC name: 2-(2,3-dichlorophenoxy)-2-phenylacetic acid. InChIKey: KVZZXAUDEDBEOL-UHFFFAOYSA-N.
| Molecular formula | C14H10Cl2O3 |
|---|---|
| Molecular weight | 297.1 g/mol |
| IUPAC name | 2-(2,3-dichlorophenoxy)-2-phenylacetic acid |
| InChIKey | KVZZXAUDEDBEOL-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C(C(=O)O)OC2=C(C(=CC=C2)Cl)Cl |
Computed by PubChem (NCBI)