CAS 93835-05-3 appears in our catalog under these names: tert-Butyl beta-Carboline-3-carboxylate, tert–Butyl 9H–pyrido(3,4–b)indole–3–carboxylate, tert-Butyl 9H-pyrido[3,4-b]indole-3-carboxylate 95%, tert-Butyl 9H-pyrido[3,4-b]indole-3-carboxylate, 95%, 95%. Offered by: TRC, GLPBio, Ambeed, Chemat. Available pack sizes: 250mg, 50mg, 100mg, 1g.
Tert-butyl 9H-pyrido[3,4-b]indole-3-carboxylate (CAS 93835-05-3) is a chemical compound with the molecular formula C16H16N2O2 and a molecular weight of 268.31 g/mol. IUPAC name: tert-butyl 9H-pyrido[3,4-b]indole-3-carboxylate. InChIKey: FVFFDKKTXYVCCW-UHFFFAOYSA-N.
| Molecular formula | C16H16N2O2 |
|---|---|
| Molecular weight | 268.31 g/mol |
| IUPAC name | tert-butyl 9H-pyrido[3,4-b]indole-3-carboxylate |
| InChIKey | FVFFDKKTXYVCCW-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)C1=NC=C2C(=C1)C3=CC=CC=C3N2 |
Computed by PubChem (NCBI)