Products 93952-23-9
CAS 93952-23-9 appears in our catalog under these names: 3,3',4,4'-Tetrachlorobiphenyl-d6, 98 atom % D, min 97% Chemical Purity, 3,3',4,4'-Tetrachlorobiphenyl-d6, >95% (HPLC), 3,3',4,4'-Tetrachloro-1,1'-biphenyl-d6, 99.0%. Offered by: CDN, TRC, MedChemExpress. Available pack sizes: 0,01g, 0,005g, 10mg, 5mg, 48 μg (134.21 μM * 1.2 mL in Nonane).
1,2-dichloro-3,4,6-trideuterio-5-(3,4-dichloro-2,5,6-trideuteriophenyl)benzene (CAS 93952-23-9) is a chemical compound with the molecular formula C12H6Cl4 and a molecular weight of 298.0 g/mol. IUPAC name: 1,2-dichloro-3,4,6-trideuterio-5-(3,4-dichloro-2,5,6-trideuteriophenyl)benzene. InChIKey: UQMGJOKDKOLIDP-MZWXYZOWSA-N.
| Molecular formula | C12H6Cl4 |
|---|---|
| Molecular weight | 298.0 g/mol |
| IUPAC name | 1,2-dichloro-3,4,6-trideuterio-5-(3,4-dichloro-2,5,6-trideuteriophenyl)benzene |
| InChIKey | UQMGJOKDKOLIDP-MZWXYZOWSA-N |
| SMILES | [2H]C1=C(C(=C(C(=C1C2=C(C(=C(C(=C2[2H])[2H])Cl)Cl)[2H])[2H])Cl)Cl)[2H] |
Computed by PubChem (NCBI)