Products 1219794-80-5
CAS 1219794-80-5 appears in our catalog under these names: 2,3,5,6-Tetrachlorobiphenyl-2',3',4',5',6'-d5, 98 atom % D, min 98% Chemical Purity, 2,3,5,6-Tetrachloro-1,1'-biphenyl-d5. Offered by: CDN, MedChemExpress. Available pack sizes: 0,01g, 1 mg.
1,2,3,4,5-pentadeuterio-6-(2,3,5,6-tetrachlorophenyl)benzene (CAS 1219794-80-5) is a chemical compound with the molecular formula C12H6Cl4 and a molecular weight of 297.0 g/mol. IUPAC name: 1,2,3,4,5-pentadeuterio-6-(2,3,5,6-tetrachlorophenyl)benzene. InChIKey: BLAYIQLVUNIICD-RALIUCGRSA-N.
| Molecular formula | C12H6Cl4 |
|---|---|
| Molecular weight | 297.0 g/mol |
| IUPAC name | 1,2,3,4,5-pentadeuterio-6-(2,3,5,6-tetrachlorophenyl)benzene |
| InChIKey | BLAYIQLVUNIICD-RALIUCGRSA-N |
| SMILES | [2H]C1=C(C(=C(C(=C1[2H])[2H])C2=C(C(=CC(=C2Cl)Cl)Cl)Cl)[2H])[2H] |
Computed by PubChem (NCBI)