CAS 1219794-77-0 appears in our catalog under these names: 2,3',4',5-Tetrachlorobiphenyl-3,4,6-d3, 98 atom % D, min 97% Chemical Purity, 2,3′,4′,5-Tetrachlorobiphenyl-3,4,6-d3. Offered by: CDN, MedChemExpress. Available pack sizes: 0,01g, 1 mg.
1,4-dichloro-2,3,5-trideuterio-6-(3,4-dichlorophenyl)benzene (CAS 1219794-77-0) is a chemical compound with the molecular formula C12H6Cl4 and a molecular weight of 295.0 g/mol. IUPAC name: 1,4-dichloro-2,3,5-trideuterio-6-(3,4-dichlorophenyl)benzene. InChIKey: KENZYIHFBRWMOD-NCYHUZTRSA-N.
| Molecular formula | C12H6Cl4 |
|---|---|
| Molecular weight | 295.0 g/mol |
| IUPAC name | 1,4-dichloro-2,3,5-trideuterio-6-(3,4-dichlorophenyl)benzene |
| InChIKey | KENZYIHFBRWMOD-NCYHUZTRSA-N |
| SMILES | [2H]C1=C(C(=C(C(=C1Cl)[2H])C2=CC(=C(C=C2)Cl)Cl)Cl)[2H] |
Computed by PubChem (NCBI)