CAS 1219794-74-7 appears in our catalog under these names: 2,2',5,5'-Tetrachlorobiphenyl-3,4,6-d3, 96 atom % D. Contains 3.2% unlabelledd0) compound. , min 98% Chemical Purity, 2,2',5,5'-Tetrachlorobiphenyl-3,4,6-d3, 2,2',5,5'-Tetrachloro-1,1'-biphenyl-d3. Offered by: CDN, TRC, MedChemExpress. Available pack sizes: 0,01g, 10mg, 10 mg.
1,4-dichloro-2,3,5-trideuterio-6-(2,5-dichlorophenyl)benzene (CAS 1219794-74-7) is a chemical compound with the molecular formula C12H6Cl4 and a molecular weight of 295.0 g/mol. IUPAC name: 1,4-dichloro-2,3,5-trideuterio-6-(2,5-dichlorophenyl)benzene. InChIKey: HCWZEPKLWVAEOV-UXHGNOADSA-N.
| Molecular formula | C12H6Cl4 |
|---|---|
| Molecular weight | 295.0 g/mol |
| IUPAC name | 1,4-dichloro-2,3,5-trideuterio-6-(2,5-dichlorophenyl)benzene |
| InChIKey | HCWZEPKLWVAEOV-UXHGNOADSA-N |
| SMILES | [2H]C1=C(C(=C(C(=C1Cl)[2H])C2=C(C=CC(=C2)Cl)Cl)Cl)[2H] |
Computed by PubChem (NCBI)