Products 36559-22-5
CAS 36559-22-5 appears in our catalog under these names: 2,2',3,4'-Tetrachlorobiphenyl, 2,2',3,4'–Tetrachlorobiphenyl, PCB 42, ROTI®Star, 10 mg, glass. Offered by: TRC, GLPBio, Biosynth, Roth. Available pack sizes: 25mg, 1ml, 50mg, 100mg, 10mg.
1,2-dichloro-3-(2,4-dichlorophenyl)benzene (CAS 36559-22-5) is a chemical compound with the molecular formula C12H6Cl4 and a molecular weight of 292.0 g/mol. IUPAC name: 1,2-dichloro-3-(2,4-dichlorophenyl)benzene. InChIKey: ALFHIHDQSYXSGP-UHFFFAOYSA-N.
| Molecular formula | C12H6Cl4 |
|---|---|
| Molecular weight | 292.0 g/mol |
| IUPAC name | 1,2-dichloro-3-(2,4-dichlorophenyl)benzene |
| InChIKey | ALFHIHDQSYXSGP-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C(=C1)Cl)Cl)C2=C(C=C(C=C2)Cl)Cl |
Computed by PubChem (NCBI)
Synonyms:
2,2',3,4'-Tetrachlorobiphenyl, 2,2',3,4'-Tetrachloro-1,1'-biphenyl, 2,4-dichloro-1-(2,3-dichlorophenyl)benzene, Aroclor 1242, 1,2-dichloro-3-(2,4-dichlorophenyl)benzene, 1,1'-Biphenyl, 2,2',3,4'-tetrachloro-, Pcb No. 42, 1,1'-Biphenyl, 2,2',3',4-tetrachloro, 2,2',3,4'-Tetrachloro-1,1'-biphenyl #