CAS 93983-01-8 appears in our catalog under these names: 2'-Amino-4',5'-methylenedioxyacetophenone hydrochloride, 95%, 1-(6-Aminobenzo(d)(1,3)dioxol-5-yl)ethanone hydrochloride, 98%, 1-(6-Aminobenzo[d][1,3]dioxol-5-yl)ethanone hydrochloride, 98%+,RG, 98%+,RG, 2'-Amino-4',5'-methylenedioxyacetophenone hydrochloride, 98%+,RG. Offered by: Combi-blocks, AmBeed, Chemat, Fluorochem. Available pack sizes: 25g, 1g, 5g, 250mg.
1-(6-amino-1,3-benzodioxol-5-yl)ethanone;hydrochloride (CAS 93983-01-8) is a chemical compound with the molecular formula C9H10ClNO3 and a molecular weight of 215.63 g/mol. IUPAC name: 1-(6-amino-1,3-benzodioxol-5-yl)ethanone;hydrochloride. InChIKey: PIVDPBIZDWHINL-UHFFFAOYSA-N.
| Molecular formula | C9H10ClNO3 |
|---|---|
| Molecular weight | 215.63 g/mol |
| IUPAC name | 1-(6-amino-1,3-benzodioxol-5-yl)ethanone;hydrochloride |
| InChIKey | PIVDPBIZDWHINL-UHFFFAOYSA-N |
| SMILES | CC(=O)C1=CC2=C(C=C1N)OCO2.Cl |
Computed by PubChem (NCBI)